C23H25F4N5O3 — CID 134584155
4-ethyl-N-(3-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperazine-1-carboxamide (PubChem CID 134584155) has the molecular formula C23H25F4N5O3 and a molecular weight of 495.48 g/mol. Its IUPAC name is 4-ethyl-N-(3-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-ethyl-N-(3-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 134584155 |
| Molecular Formula | C23H25F4N5O3 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-ethyl-N-(3-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)N(Cc2ccc(C(=O)NNC(=O)C(F)(F)F)cc2)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H25F4N5O3/c1-2-30-10-12-31(13-11-30)22(35)32(19-5-3-4-18(24)14-19)15-16-6-8-17(9-7-16)20(33)28-29-21(34)23(25,26)27/h3-9,14H,2,10-13,15H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | PFRAVMCSEFNQCT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|