C19H21FN4O3 — CID 134584270
methyl 6-[[4-fluoro-N-(piperazine-1-carbonyl)anilino]methyl]pyridine-3-carboxylate (PubChem CID 134584270) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is methyl 6-[[4-fluoro-N-(piperazine-1-carbonyl)anilino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[4-fluoro-N-(piperazine-1-carbonyl)anilino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134584270 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | methyl 6-[[4-fluoro-N-(piperazine-1-carbonyl)anilino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCNCC2)c2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C19H21FN4O3/c1-27-18(25)14-2-5-16(22-12-14)13-24(17-6-3-15(20)4-7-17)19(26)23-10-8-21-9-11-23/h2-7,12,21H,8-11,13H2,1H3 |
| InChIKey | MXRBPMPGRFUZBZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |