C22H23F3N4O3S — CID 134584339
N-(2-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide (PubChem CID 134584339) has the molecular formula C22H23F3N4O3S and a molecular weight of 480.51 g/mol. Its IUPAC name is N-(2-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide.
| Compound Name | N-(2-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584339 |
| Molecular Formula | C22H23F3N4O3S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-(2-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide |
| SMILES | Cc1ccccc1N(Cc1ccc(C(=O)NNC(=O)C(F)(F)F)cc1)C(=O)N1CCSCC1 |
| InChI | InChI=1S/C22H23F3N4O3S/c1-15-4-2-3-5-18(15)29(21(32)28-10-12-33-13-11-28)14-16-6-8-17(9-7-16)19(30)26-27-20(31)22(23,24)25/h2-9H,10-14H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | XDLAKZPMQYBUJW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|