About [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid
[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid (PubChem CID 134584537) has the molecular formula C17H13F2N3O3
and a molecular weight of 345.31 g/mol. Its IUPAC name is [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid.
Molecular Properties
| Compound Name | [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid |
| PubChem CID | 134584537 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid |
| SMILES | O=C(O)N(Cc1ccc(-c2nnc(C(F)F)o2)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H13F2N3O3/c18-14(19)16-21-20-15(25-16)12-8-6-11(7-9-12)10-22(17(23)24)13-4-2-1-3-5-13/h1-9,14H,10H2,(H,23,24) |
| InChIKey | OSYCSHREVLKZMU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid?
The IUPAC name of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid (CID 134584537) is [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid.
What is the SMILES notation for [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid?
The canonical SMILES for [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid is O=C(O)N(Cc1ccc(-c2nnc(C(F)F)o2)cc1)c1ccccc1.
What is the InChIKey of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid?
The InChIKey is OSYCSHREVLKZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N3O3/c18-14(19)16-21-20-15(25-16)12-8-6-11(7-9-12)10-22(17(23)24)13-4-2-1-3-5-13/h1-9,14H,10H2,(H,23,24).
What are the key properties of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid?
[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid has a molecular weight of 345.31 g/mol, XLogP of 4.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl-phenylcarbamic acid is sourced from PubChem (CID 134584537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).