About tert-butyl 3,5-dioxohept-6-enoate
tert-butyl 3,5-dioxohept-6-enoate (PubChem CID 134584884) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is tert-butyl 3,5-dioxohept-6-enoate.
Molecular Properties
| Compound Name | tert-butyl 3,5-dioxohept-6-enoate |
| PubChem CID | 134584884 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | tert-butyl 3,5-dioxohept-6-enoate |
| SMILES | C=CC(=O)CC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H16O4/c1-5-8(12)6-9(13)7-10(14)15-11(2,3)4/h5H,1,6-7H2,2-4H3 |
| InChIKey | GYDDBYFXUJSSPU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3,5-dioxohept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,5-dioxohept-6-enoate?
The IUPAC name of tert-butyl 3,5-dioxohept-6-enoate (CID 134584884) is tert-butyl 3,5-dioxohept-6-enoate.
What is the SMILES notation for tert-butyl 3,5-dioxohept-6-enoate?
The canonical SMILES for tert-butyl 3,5-dioxohept-6-enoate is C=CC(=O)CC(=O)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3,5-dioxohept-6-enoate?
The InChIKey is GYDDBYFXUJSSPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-5-8(12)6-9(13)7-10(14)15-11(2,3)4/h5H,1,6-7H2,2-4H3.
What are the key properties of tert-butyl 3,5-dioxohept-6-enoate?
tert-butyl 3,5-dioxohept-6-enoate has a molecular weight of 212.24 g/mol, XLogP of 1.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,5-dioxohept-6-enoate is sourced from PubChem (CID 134584884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).