C33H41FN6O4S — CID 134584975
N-[4-[[(2S,6R)-4-benzyl-2,6-dimethylpiperazin-1-yl]methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 134584975) has the molecular formula C33H41FN6O4S and a molecular weight of 636.79 g/mol. Its IUPAC name is N-[4-[[(2S,6R)-4-benzyl-2,6-dimethylpiperazin-1-yl]methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-[4-[[(2S,6R)-4-benzyl-2,6-dimethylpiperazin-1-yl]methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 134584975 |
| Molecular Formula | C33H41FN6O4S |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | N-[4-[[(2S,6R)-4-benzyl-2,6-dimethylpiperazin-1-yl]methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@H](C)N1Cc1ccc(N(Cc2ccc(C(=O)NN)cc2F)C(=O)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C33H41FN6O4S/c1-24-19-37(21-26-6-4-3-5-7-26)20-25(2)39(24)22-27-8-12-30(13-9-27)40(33(42)38-14-16-45(43,44)17-15-38)23-29-11-10-28(18-31(29)34)32(41)36-35/h3-13,18,24-25H,14-17,19-23,35H2,1-2H3,(H,36,41)/t24-,25+ |
| InChIKey | YFERDGOVOUHIIL-PLQXJYEYSA-N |
| XLogP | 3.38 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|