C20H19FN2O2 — CID 134585961
2-[[2-[(1R)-1-(azetidin-1-yl)ethyl]-6-fluorophenyl]methyl]isoindole-1,3-dione (PubChem CID 134585961) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-[[2-[(1R)-1-(azetidin-1-yl)ethyl]-6-fluorophenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-[(1R)-1-(azetidin-1-yl)ethyl]-6-fluorophenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134585961 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[[2-[(1R)-1-(azetidin-1-yl)ethyl]-6-fluorophenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H](c1cccc(F)c1CN1C(=O)c2ccccc2C1=O)N1CCC1 |
| InChI | InChI=1S/C20H19FN2O2/c1-13(22-10-5-11-22)14-8-4-9-18(21)17(14)12-23-19(24)15-6-2-3-7-16(15)20(23)25/h2-4,6-9,13H,5,10-12H2,1H3/t13-/m1/s1 |
| InChIKey | ZMQLDSIYQUQULQ-CYBMUJFWSA-N |
| XLogP | 3.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|