About 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate
1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate (PubChem CID 134586687) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate.
Molecular Properties
| Compound Name | 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate |
| PubChem CID | 134586687 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate |
| SMILES | C=Cc1ccc(C=C)c(C)c1C.O.O |
| InChI | InChI=1S/C12H14.2H2O/c1-5-11-7-8-12(6-2)10(4)9(11)3;;/h5-8H,1-2H2,3-4H3;2*1H2 |
| InChIKey | LTNNZZZHSWPOFD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate?
The IUPAC name of 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate (CID 134586687) is 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate.
What is the SMILES notation for 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate?
The canonical SMILES for 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate is C=Cc1ccc(C=C)c(C)c1C.O.O.
What is the InChIKey of 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate?
The InChIKey is LTNNZZZHSWPOFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.2H2O/c1-5-11-7-8-12(6-2)10(4)9(11)3;;/h5-8H,1-2H2,3-4H3;2*1H2.
What are the key properties of 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate?
1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate has a molecular weight of 194.27 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(ethenyl)-2,3-dimethylbenzene;dihydrate is sourced from PubChem (CID 134586687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).