C14H24O — CID 134587249
7,7,8,8-tetramethyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 134587249) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 7,7,8,8-tetramethyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | 7,7,8,8-tetramethyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 134587249 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 7,7,8,8-tetramethyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1(C)CCC2CCCC(=O)C2C1(C)C |
| InChI | InChI=1S/C14H24O/c1-13(2)9-8-10-6-5-7-11(15)12(10)14(13,3)4/h10,12H,5-9H2,1-4H3 |
| InChIKey | DCNFPBLHKAFSFU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |