C18H21ClF3N3O3 — CID 134587338
tert-butyl 2-chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate (PubChem CID 134587338) has the molecular formula C18H21ClF3N3O3 and a molecular weight of 419.83 g/mol. Its IUPAC name is tert-butyl 2-chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134587338 |
| Molecular Formula | C18H21ClF3N3O3 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | tert-butyl 2-chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-n2ccc(OCC(C)(C)C(F)(F)F)n2)nc1Cl |
| InChI | InChI=1S/C18H21ClF3N3O3/c1-16(2,3)28-15(26)11-6-7-12(23-14(11)19)25-9-8-13(24-25)27-10-17(4,5)18(20,21)22/h6-9H,10H2,1-5H3 |
| InChIKey | HNXJOEOOIOBYFJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|