About 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole
5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole (PubChem CID 134587342) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole |
| PubChem CID | 134587342 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole |
| SMILES | c1cc(O[C@H]2C[C@@H]3CC[C@H]2C3)[nH]n1 |
| InChI | InChI=1S/C10H14N2O/c1-2-8-5-7(1)6-9(8)13-10-3-4-11-12-10/h3-4,7-9H,1-2,5-6H2,(H,11,12)/t7-,8+,9+/m1/s1 |
| InChIKey | ANYWKCPPGAHPQN-VGMNWLOBSA-N |
| XLogP | 1.98 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole?
The IUPAC name of 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole (CID 134587342) is 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole.
What is the SMILES notation for 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole?
The canonical SMILES for 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole is c1cc(O[C@H]2C[C@@H]3CC[C@H]2C3)[nH]n1.
What is the InChIKey of 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole?
The InChIKey is ANYWKCPPGAHPQN-VGMNWLOBSA-N. The full InChI is InChI=1S/C10H14N2O/c1-2-8-5-7(1)6-9(8)13-10-3-4-11-12-10/h3-4,7-9H,1-2,5-6H2,(H,11,12)/t7-,8+,9+/m1/s1.
What are the key properties of 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole?
5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole has a molecular weight of 178.23 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-1H-pyrazole is sourced from PubChem (CID 134587342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).