C34H50N4O9S2 — CID 134587533
ethyl 3-[2-[2-[2-[2-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 134587533) has the molecular formula C34H50N4O9S2 and a molecular weight of 722.93 g/mol. Its IUPAC name is ethyl 3-[2-[2-[2-[2-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | ethyl 3-[2-[2-[2-[2-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 134587533 |
| Molecular Formula | C34H50N4O9S2 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.30 |
| IUPAC Name | ethyl 3-[2-[2-[2-[2-[2-[2-[[3-[[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]amino]-3-oxopropyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CCOC(=O)CCOCCOCCOCCOCCOCCOCCNCCC(=O)Nc1sc2c(c1-c1nc3ccccc3s1)CCNC2 |
| InChI | InChI=1S/C34H50N4O9S2/c1-2-47-31(40)9-13-41-15-17-43-19-21-45-23-24-46-22-20-44-18-16-42-14-12-35-11-8-30(39)38-34-32(26-7-10-36-25-29(26)49-34)33-37-27-5-3-4-6-28(27)48-33/h3-6,35-36H,2,7-25H2,1H3,(H,38,39) |
| InChIKey | YUEHVDMWKZVODD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 147.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|