C24H26ClN7OS — CID 134587582
[(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone (PubChem CID 134587582) has the molecular formula C24H26ClN7OS and a molecular weight of 496.04 g/mol. Its IUPAC name is [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone.
| Compound Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 134587582 |
| Molecular Formula | C24H26ClN7OS |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone |
| SMILES | CN(C)[C@H]1CCN(C(=O)[C@H]2CCc3c(sc4ncnc(Nc5cc6ccnn6cc5Cl)c34)C2)C1 |
| InChI | InChI=1S/C24H26ClN7OS/c1-30(2)16-6-8-31(11-16)24(33)14-3-4-17-20(9-14)34-23-21(17)22(26-13-27-23)29-19-10-15-5-7-28-32(15)12-18(19)25/h5,7,10,12-14,16H,3-4,6,8-9,11H2,1-2H3,(H,26,27,29)/t14-,16-/m0/s1 |
| InChIKey | OXKGBMFHQKTRPN-HOCLYGCPSA-N |
| XLogP | 4.00 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |