About 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine
1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine (PubChem CID 134587942) has the molecular formula C13H30N4
and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine |
| PubChem CID | 134587942 |
| Molecular Formula | C13H30N4 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine |
| SMILES | CC1C(NCCCN)CCCC1NCCCN |
| InChI | InChI=1S/C13H30N4/c1-11-12(16-9-3-7-14)5-2-6-13(11)17-10-4-8-15/h11-13,16-17H,2-10,14-15H2,1H3 |
| InChIKey | SHFREFKVPBGHKS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine?
The IUPAC name of 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine (CID 134587942) is 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine.
What is the SMILES notation for 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine?
The canonical SMILES for 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine is CC1C(NCCCN)CCCC1NCCCN.
What is the InChIKey of 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine?
The InChIKey is SHFREFKVPBGHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N4/c1-11-12(16-9-3-7-14)5-2-6-13(11)17-10-4-8-15/h11-13,16-17H,2-10,14-15H2,1H3.
What are the key properties of 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine?
1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine has a molecular weight of 242.41 g/mol, XLogP of 0.42, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis(3-aminopropyl)-2-methylcyclohexane-1,3-diamine is sourced from PubChem (CID 134587942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).