About 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one
6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one (PubChem CID 134588179) has the molecular formula C24H22N4O
and a molecular weight of 382.47 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one |
| PubChem CID | 134588179 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(-c2cccnc2)c(=O)c2cc(NC3Cc4ccccc4C3)cnc21 |
| InChI | InChI=1S/C24H22N4O/c1-2-28-15-22(18-8-5-9-25-13-18)23(29)21-12-20(14-26-24(21)28)27-19-10-16-6-3-4-7-17(16)11-19/h3-9,12-15,19,27H,2,10-11H2,1H3 |
| InChIKey | CYIQDAYZGQOWJZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one?
The IUPAC name of 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one (CID 134588179) is 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one.
What is the SMILES notation for 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one?
The canonical SMILES for 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one is CCn1cc(-c2cccnc2)c(=O)c2cc(NC3Cc4ccccc4C3)cnc21.
What is the InChIKey of 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one?
The InChIKey is CYIQDAYZGQOWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O/c1-2-28-15-22(18-8-5-9-25-13-18)23(29)21-12-20(14-26-24(21)28)27-19-10-16-6-3-4-7-17(16)11-19/h3-9,12-15,19,27H,2,10-11H2,1H3.
What are the key properties of 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one?
6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one has a molecular weight of 382.47 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-pyridin-3-yl-1,8-naphthyridin-4-one is sourced from PubChem (CID 134588179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).