C22H21N3O2 — CID 134588371
6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-(3-hydroxyprop-1-ynyl)-1,8-naphthyridin-4-one (PubChem CID 134588371) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-(3-hydroxyprop-1-ynyl)-1,8-naphthyridin-4-one.
| Compound Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-(3-hydroxyprop-1-ynyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 134588371 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-(3-hydroxyprop-1-ynyl)-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(C#CCO)c(=O)c2cc(NC3Cc4ccccc4C3)cnc21 |
| InChI | InChI=1S/C22H21N3O2/c1-2-25-14-17(8-5-9-26)21(27)20-12-19(13-23-22(20)25)24-18-10-15-6-3-4-7-16(15)11-18/h3-4,6-7,12-14,18,24,26H,2,9-11H2,1H3 |
| InChIKey | KFFOYABQXWNHMP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|