C27H27N5O3 — CID 134589052
N-benzhydryl-2-nitro-4-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]aniline (PubChem CID 134589052) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-benzhydryl-2-nitro-4-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]aniline.
| Compound Name | N-benzhydryl-2-nitro-4-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 134589052 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-benzhydryl-2-nitro-4-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]aniline |
| SMILES | O=[N+]([O-])c1cc(N2CCN(Cc3ccon3)CC2)ccc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27N5O3/c33-32(34)26-19-24(31-16-14-30(15-17-31)20-23-13-18-35-29-23)11-12-25(26)28-27(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-13,18-19,27-28H,14-17,20H2 |
| InChIKey | JGELVVCQBWSPLA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|