C6H8N6 — CID 134589223
1-(1-methyltriazol-4-yl)pyrazol-3-amine (PubChem CID 134589223) has the molecular formula C6H8N6 and a molecular weight of 164.17 g/mol. Its IUPAC name is 1-(1-methyltriazol-4-yl)pyrazol-3-amine.
| Compound Name | 1-(1-methyltriazol-4-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 134589223 |
| Molecular Formula | C6H8N6 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-(1-methyltriazol-4-yl)pyrazol-3-amine |
| SMILES | Cn1cc(-n2ccc(N)n2)nn1 |
| InChI | InChI=1S/C6H8N6/c1-11-4-6(8-10-11)12-3-2-5(7)9-12/h2-4H,1H3,(H2,7,9) |
| InChIKey | JUOIAVUXZJSKDQ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |