C16H19FN2O — CID 134589424
3-(3-fluorophenyl)-6-methyl-6-prop-2-enyl-1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazol-5-one (PubChem CID 134589424) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-6-methyl-6-prop-2-enyl-1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazol-5-one.
| Compound Name | 3-(3-fluorophenyl)-6-methyl-6-prop-2-enyl-1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazol-5-one |
|---|---|
| PubChem CID | 134589424 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-(3-fluorophenyl)-6-methyl-6-prop-2-enyl-1,2,3,7-tetrahydropyrazolo[1,2-a]pyrazol-5-one |
| SMILES | C=CCC1(C)CN2CCC(c3cccc(F)c3)N2C1=O |
| InChI | InChI=1S/C16H19FN2O/c1-3-8-16(2)11-18-9-7-14(19(18)15(16)20)12-5-4-6-13(17)10-12/h3-6,10,14H,1,7-9,11H2,2H3 |
| InChIKey | KODNONQBQYAKIO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|