C18H16F2N4O — CID 134589500
N-[3,5-difluoro-4-(oxolan-3-yl)phenyl]-1-phenyl-1,2,4-triazol-3-amine (PubChem CID 134589500) has the molecular formula C18H16F2N4O and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[3,5-difluoro-4-(oxolan-3-yl)phenyl]-1-phenyl-1,2,4-triazol-3-amine.
| Compound Name | N-[3,5-difluoro-4-(oxolan-3-yl)phenyl]-1-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134589500 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[3,5-difluoro-4-(oxolan-3-yl)phenyl]-1-phenyl-1,2,4-triazol-3-amine |
| SMILES | Fc1cc(Nc2ncn(-c3ccccc3)n2)cc(F)c1C1CCOC1 |
| InChI | InChI=1S/C18H16F2N4O/c19-15-8-13(9-16(20)17(15)12-6-7-25-10-12)22-18-21-11-24(23-18)14-4-2-1-3-5-14/h1-5,8-9,11-12H,6-7,10H2,(H,22,23) |
| InChIKey | ITWGDEURGWXAJU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |