C22H24F2N6O — CID 134589742
1-(3,4-difluorophenyl)-N-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-amine (PubChem CID 134589742) has the molecular formula C22H24F2N6O and a molecular weight of 426.47 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-amine.
| Compound Name | 1-(3,4-difluorophenyl)-N-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134589742 |
| Molecular Formula | C22H24F2N6O |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-[3-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(Nc2ncn(-c3ccc(F)c(F)c3)n2)ccc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C22H24F2N6O/c1-15-10-16(2-5-21(15)29-8-6-28(7-9-29)18-12-31-13-18)26-22-25-14-30(27-22)17-3-4-19(23)20(24)11-17/h2-5,10-11,14,18H,6-9,12-13H2,1H3,(H,26,27) |
| InChIKey | JSFYOQAPJQGAPL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|