C15H15N5O2 — CID 134589915
N-(3,5-dimethoxyphenyl)-1-pyridin-3-yl-1,2,4-triazol-3-amine (PubChem CID 134589915) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-pyridin-3-yl-1,2,4-triazol-3-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-pyridin-3-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134589915 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-pyridin-3-yl-1,2,4-triazol-3-amine |
| SMILES | COc1cc(Nc2ncn(-c3cccnc3)n2)cc(OC)c1 |
| InChI | InChI=1S/C15H15N5O2/c1-21-13-6-11(7-14(8-13)22-2)18-15-17-10-20(19-15)12-4-3-5-16-9-12/h3-10H,1-2H3,(H,18,19) |
| InChIKey | WFAODGFNPUEMRP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |