C17H17N5O — CID 134589998
4-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 134589998) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 4-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 4-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 134589998 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | CN1CCOc2cc(Nc3ncn(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C17H17N5O/c1-21-9-10-23-16-11-13(7-8-15(16)21)19-17-18-12-22(20-17)14-5-3-2-4-6-14/h2-8,11-12H,9-10H2,1H3,(H,19,20) |
| InChIKey | MCVNTVQUTFXSGE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|