About 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine
5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine (PubChem CID 134590073) has the molecular formula C11H12N8
and a molecular weight of 256.27 g/mol. Its IUPAC name is 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine |
| PubChem CID | 134590073 |
| Molecular Formula | C11H12N8 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine |
| SMILES | Cc1cc(N)c(-n2ccnn2)c(N)c1-n1ccnn1 |
| InChI | InChI=1S/C11H12N8/c1-7-6-8(12)11(19-5-3-15-17-19)9(13)10(7)18-4-2-14-16-18/h2-6H,12-13H2,1H3 |
| InChIKey | PFBNAAVOYNELGZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine?
The IUPAC name of 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine (CID 134590073) is 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine.
What is the SMILES notation for 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine?
The canonical SMILES for 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine is Cc1cc(N)c(-n2ccnn2)c(N)c1-n1ccnn1.
What is the InChIKey of 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine?
The InChIKey is PFBNAAVOYNELGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N8/c1-7-6-8(12)11(19-5-3-15-17-19)9(13)10(7)18-4-2-14-16-18/h2-6H,12-13H2,1H3.
What are the key properties of 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine?
5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine has a molecular weight of 256.27 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,4-bis(triazol-1-yl)benzene-1,3-diamine is sourced from PubChem (CID 134590073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).