About US10093664, Example 67
US10093664, Example 67 (PubChem CID 134590085) has the molecular formula C22H28F3N5O3
and a molecular weight of 467.50 g/mol. Its IUPAC name is 1-[4-[6-amino-5-(trifluoromethoxy)-3-pyridinyl]-1-(3-morpholin-4-yl-1-bicyclo[1.1.1]pentanyl)imidazol-2-yl]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | US10093664, Example 67 |
| PubChem CID | 134590085 |
| Molecular Formula | C22H28F3N5O3 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-[4-[6-amino-5-(trifluoromethoxy)-3-pyridinyl]-1-(3-morpholin-4-yl-1-bicyclo[1.1.1]pentanyl)imidazol-2-yl]-2-methylpropan-1-ol |
| SMILES | CC(C)C(C1=NC(=CN1C23CC(C2)(C3)N4CCOCC4)C5=CC(=C(N=C5)N)OC(F)(F)F)O |
| InChI | InChI=1S/C22H28F3N5O3/c1-13(2)17(31)19-28-15(14-7-16(18(26)27-8-14)33-22(23,24)25)9-30(19)21-10-20(11-21,12-21)29-3-5-32-6-4-29/h7-9,13,17,31H,3-6,10-12H2,1-2H3,(H2,26,27) |
| InChIKey | KAUITHCNCVKECM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | 700 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze US10093664, Example 67 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10093664, Example 67?
The IUPAC name of US10093664, Example 67 (CID 134590085) is 1-[4-[6-amino-5-(trifluoromethoxy)-3-pyridinyl]-1-(3-morpholin-4-yl-1-bicyclo[1.1.1]pentanyl)imidazol-2-yl]-2-methylpropan-1-ol.
What is the SMILES notation for US10093664, Example 67?
The canonical SMILES for US10093664, Example 67 is CC(C)C(C1=NC(=CN1C23CC(C2)(C3)N4CCOCC4)C5=CC(=C(N=C5)N)OC(F)(F)F)O.
What is the InChIKey of US10093664, Example 67?
The InChIKey is KAUITHCNCVKECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28F3N5O3/c1-13(2)17(31)19-28-15(14-7-16(18(26)27-8-14)33-22(23,24)25)9-30(19)21-10-20(11-21,12-21)29-3-5-32-6-4-29/h7-9,13,17,31H,3-6,10-12H2,1-2H3,(H2,26,27).
What are the key properties of US10093664, Example 67?
US10093664, Example 67 has a molecular weight of 467.50 g/mol, XLogP of 1.90, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for US10093664, Example 67 is sourced from PubChem (CID 134590085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).