C18H15NOS — CID 13459029
1-phenyl-4,5-dihydro-3H-[1,4]thiazepino[4,3-b]isoindol-7-one (PubChem CID 13459029) has the molecular formula C18H15NOS and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-phenyl-4,5-dihydro-3H-[1,4]thiazepino[4,3-b]isoindol-7-one.
| Compound Name | 1-phenyl-4,5-dihydro-3H-[1,4]thiazepino[4,3-b]isoindol-7-one |
|---|---|
| PubChem CID | 13459029 |
| Molecular Formula | C18H15NOS |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-phenyl-4,5-dihydro-3H-[1,4]thiazepino[4,3-b]isoindol-7-one |
| SMILES | O=C1c2ccccc2C2=C(c3ccccc3)SCCCN12 |
| InChI | InChI=1S/C18H15NOS/c20-18-15-10-5-4-9-14(15)16-17(13-7-2-1-3-8-13)21-12-6-11-19(16)18/h1-5,7-10H,6,11-12H2 |
| InChIKey | QTKPDTGUHYTZOP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|