About 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole
2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole (PubChem CID 134590299) has the molecular formula C39H31N2OP
and a molecular weight of 574.66 g/mol. Its IUPAC name is 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole.
Molecular Properties
| Compound Name | 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole |
| PubChem CID | 134590299 |
| Molecular Formula | C39H31N2OP |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole |
| SMILES | CCn1c(-c2c(P(=O)(c3ccccc3)c3ccccc3)ccc3ccccc23)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C39H31N2OP/c1-2-41-38(31-20-9-4-10-21-31)37(30-18-7-3-8-19-30)40-39(41)36-34-26-16-15-17-29(34)27-28-35(36)43(42,32-22-11-5-12-23-32)33-24-13-6-14-25-33/h3-28H,2H2,1H3 |
| InChIKey | JAEAVHLVVGBWSY-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole?
The IUPAC name of 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole (CID 134590299) is 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole.
What is the SMILES notation for 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole?
The canonical SMILES for 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole is CCn1c(-c2c(P(=O)(c3ccccc3)c3ccccc3)ccc3ccccc23)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole?
The InChIKey is JAEAVHLVVGBWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H31N2OP/c1-2-41-38(31-20-9-4-10-21-31)37(30-18-7-3-8-19-30)40-39(41)36-34-26-16-15-17-29(34)27-28-35(36)43(42,32-22-11-5-12-23-32)33-24-13-6-14-25-33/h3-28H,2H2,1H3.
What are the key properties of 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole?
2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole has a molecular weight of 574.66 g/mol, XLogP of 8.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-diphenylphosphorylnaphthalen-1-yl)-1-ethyl-4,5-diphenylimidazole is sourced from PubChem (CID 134590299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).