C35H41N9O2 — CID 134590530
(E)-2-[2-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]azetidine-1-carbonyl]-6-methyl-6-(4-methylpiperazin-1-yl)hept-2-enenitrile (PubChem CID 134590530) has the molecular formula C35H41N9O2 and a molecular weight of 619.77 g/mol. Its IUPAC name is (E)-2-[2-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]azetidine-1-carbonyl]-6-methyl-6-(4-methylpiperazin-1-yl)hept-2-enenitrile.
| Compound Name | (E)-2-[2-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]azetidine-1-carbonyl]-6-methyl-6-(4-methylpiperazin-1-yl)hept-2-enenitrile |
|---|---|
| PubChem CID | 134590530 |
| Molecular Formula | C35H41N9O2 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | (E)-2-[2-[[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]azetidine-1-carbonyl]-6-methyl-6-(4-methylpiperazin-1-yl)hept-2-enenitrile |
| SMILES | CN1CCN(C(C)(C)CC/C=C(\C#N)C(=O)N2CCC2Cn2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C35H41N9O2/c1-35(2,42-20-18-41(3)19-21-42)16-7-8-26(22-36)34(45)43-17-15-27(43)23-44-33-30(32(37)38-24-39-33)31(40-44)25-11-13-29(14-12-25)46-28-9-5-4-6-10-28/h4-6,8-14,24,27H,7,15-21,23H2,1-3H3,(H2,37,38,39)/b26-8+ |
| InChIKey | RCBVTIRFPPLNHO-MWRNPHMMSA-N |
| XLogP | 4.72 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|