About 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine
2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine (PubChem CID 134590760) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine.
Molecular Properties
| Compound Name | 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine |
| PubChem CID | 134590760 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine |
| SMILES | C/C=C\C(=C/N=C(N)N)C(C)(C)C |
| InChI | InChI=1S/C10H19N3/c1-5-6-8(10(2,3)4)7-13-9(11)12/h5-7H,1-4H3,(H4,11,12,13)/b6-5-,8-7+ |
| InChIKey | GLENLOVBCHSEFC-IGTJQSIKSA-N |
| XLogP | 1.77 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine?
The IUPAC name of 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine (CID 134590760) is 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine.
What is the SMILES notation for 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine?
The canonical SMILES for 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine is C/C=C\C(=C/N=C(N)N)C(C)(C)C.
What is the InChIKey of 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine?
The InChIKey is GLENLOVBCHSEFC-IGTJQSIKSA-N. The full InChI is InChI=1S/C10H19N3/c1-5-6-8(10(2,3)4)7-13-9(11)12/h5-7H,1-4H3,(H4,11,12,13)/b6-5-,8-7+.
What are the key properties of 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine?
2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine has a molecular weight of 181.28 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]guanidine is sourced from PubChem (CID 134590760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).