About N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine
N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine (PubChem CID 134590822) has the molecular formula C13H15NS
and a molecular weight of 217.34 g/mol. Its IUPAC name is N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine.
Molecular Properties
| Compound Name | N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine |
| PubChem CID | 134590822 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine |
| SMILES | C=N/C1=C(\C=C/C)SC(=C)/C=C\C=C/C1 |
| InChI | InChI=1S/C13H15NS/c1-4-8-13-12(14-3)10-7-5-6-9-11(2)15-13/h4-9H,2-3,10H2,1H3/b7-5-,8-4-,9-6-,13-12+ |
| InChIKey | MHKNEYKXJSBDFW-NIUQMXKDSA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine?
The IUPAC name of N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine (CID 134590822) is N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine.
What is the SMILES notation for N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine?
The canonical SMILES for N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine is C=N/C1=C(\C=C/C)SC(=C)/C=C\C=C/C1.
What is the InChIKey of N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine?
The InChIKey is MHKNEYKXJSBDFW-NIUQMXKDSA-N. The full InChI is InChI=1S/C13H15NS/c1-4-8-13-12(14-3)10-7-5-6-9-11(2)15-13/h4-9H,2-3,10H2,1H3/b7-5-,8-4-,9-6-,13-12+.
What are the key properties of N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine?
N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine has a molecular weight of 217.34 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,5Z,7Z)-9-methylidene-2-[(Z)-prop-1-enyl]-4H-thionin-3-yl]methanimine is sourced from PubChem (CID 134590822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).