C26H23F4N9O — CID 134590972
2,2,2-trifluoro-1-(4-fluorophenyl)-1-[2-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanol (PubChem CID 134590972) has the molecular formula C26H23F4N9O and a molecular weight of 553.52 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-fluorophenyl)-1-[2-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-(4-fluorophenyl)-1-[2-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanol |
|---|---|
| PubChem CID | 134590972 |
| Molecular Formula | C26H23F4N9O |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-fluorophenyl)-1-[2-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanol |
| SMILES | Cn1cc(-c2cc3c(N4CCN(c5ncc(C(O)(c6ccc(F)cc6)C(F)(F)F)cn5)CC4)ncnn3c2)cn1 |
| InChI | InChI=1S/C26H23F4N9O/c1-36-14-18(11-34-36)17-10-22-23(33-16-35-39(22)15-17)37-6-8-38(9-7-37)24-31-12-20(13-32-24)25(40,26(28,29)30)19-2-4-21(27)5-3-19/h2-5,10-16,40H,6-9H2,1H3 |
| InChIKey | MNVSESFQBBSQSG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |