C25H42FN — CID 134591212
(8E,10Z,12E,15Z)-4-ethyl-13-fluoro-11,15-dimethyl-5-(2-methylprop-2-enyl)heptadeca-8,10,12,15-tetraen-4-amine (PubChem CID 134591212) has the molecular formula C25H42FN and a molecular weight of 375.62 g/mol. Its IUPAC name is (8E,10Z,12E,15Z)-4-ethyl-13-fluoro-11,15-dimethyl-5-(2-methylprop-2-enyl)heptadeca-8,10,12,15-tetraen-4-amine.
| Compound Name | (8E,10Z,12E,15Z)-4-ethyl-13-fluoro-11,15-dimethyl-5-(2-methylprop-2-enyl)heptadeca-8,10,12,15-tetraen-4-amine |
|---|---|
| PubChem CID | 134591212 |
| Molecular Formula | C25H42FN |
| Molecular Weight | 375.62 g/mol |
| Exact Mass | 375.33 |
| IUPAC Name | (8E,10Z,12E,15Z)-4-ethyl-13-fluoro-11,15-dimethyl-5-(2-methylprop-2-enyl)heptadeca-8,10,12,15-tetraen-4-amine |
| SMILES | C=C(C)CC(CC/C=C/C=C(C)\C=C(\F)C/C(C)=C\C)C(N)(CC)CCC |
| InChI | InChI=1S/C25H42FN/c1-8-16-25(27,10-3)23(17-20(4)5)15-13-11-12-14-22(7)19-24(26)18-21(6)9-2/h9,11-12,14,19,23H,4,8,10,13,15-18,27H2,1-3,5-7H3/b12-11+,21-9-,22-14-,24-19+ |
| InChIKey | DUUWGISWVMPTED-BQNIFNJASA-N |
| XLogP | 7.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|