C22H30FN — CID 134591286
2-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-1-[4-(4-fluorobut-1-ynyl)cyclohexa-1,5-dien-1-yl]-N-methylethanimine (PubChem CID 134591286) has the molecular formula C22H30FN and a molecular weight of 327.49 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-1-[4-(4-fluorobut-1-ynyl)cyclohexa-1,5-dien-1-yl]-N-methylethanimine.
| Compound Name | 2-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-1-[4-(4-fluorobut-1-ynyl)cyclohexa-1,5-dien-1-yl]-N-methylethanimine |
|---|---|
| PubChem CID | 134591286 |
| Molecular Formula | C22H30FN |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 2-(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)-1-[4-(4-fluorobut-1-ynyl)cyclohexa-1,5-dien-1-yl]-N-methylethanimine |
| SMILES | C=C(C)C1CC(C/C(=N/C)C2=CCC(C#CCCF)C=C2)C1(C)C |
| InChI | InChI=1S/C22H30FN/c1-16(2)20-14-19(22(20,3)4)15-21(24-5)18-11-9-17(10-12-18)8-6-7-13-23/h9,11-12,17,19-20H,1,7,10,13-15H2,2-5H3/b24-21- |
| InChIKey | SLHPNROFHUVZFI-FLFQWRMESA-N |
| XLogP | 5.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|