C10H13NO3 — CID 134591352
methyl 3-(5-hydroxy-2-pyridinyl)-2-methylpropanoate (PubChem CID 134591352) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl 3-(5-hydroxy-2-pyridinyl)-2-methylpropanoate.
| Compound Name | methyl 3-(5-hydroxy-2-pyridinyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 134591352 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | methyl 3-(5-hydroxy-2-pyridinyl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)Cc1ccc(O)cn1 |
| InChI | InChI=1S/C10H13NO3/c1-7(10(13)14-2)5-8-3-4-9(12)6-11-8/h3-4,6-7,12H,5H2,1-2H3 |
| InChIKey | PRTYGYFKJHGPOL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |