C20H31N — CID 134591386
3-(2-propan-2-ylbut-3-enyl)-5-(4-propylcyclohexa-1,3-dien-1-yl)-3,4-dihydro-2H-pyrrole (PubChem CID 134591386) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is 3-(2-propan-2-ylbut-3-enyl)-5-(4-propylcyclohexa-1,3-dien-1-yl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 3-(2-propan-2-ylbut-3-enyl)-5-(4-propylcyclohexa-1,3-dien-1-yl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 134591386 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 3-(2-propan-2-ylbut-3-enyl)-5-(4-propylcyclohexa-1,3-dien-1-yl)-3,4-dihydro-2H-pyrrole |
| SMILES | C=CC(CC1CN=C(C2=CC=C(CCC)CC2)C1)C(C)C |
| InChI | InChI=1S/C20H31N/c1-5-7-16-8-10-19(11-9-16)20-13-17(14-21-20)12-18(6-2)15(3)4/h6,8,10,15,17-18H,2,5,7,9,11-14H2,1,3-4H3 |
| InChIKey | JFCWKLHLSQOYAE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|