C25H31FN6O5 — CID 134591535
[3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-methylphenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 134591535) has the molecular formula C25H31FN6O5 and a molecular weight of 514.56 g/mol. Its IUPAC name is [3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-methylphenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | [3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-methylphenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 134591535 |
| Molecular Formula | C25H31FN6O5 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | [3-[6-[3-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyimino]azetidin-1-yl]-5-fluoro-3-pyridinyl]-2-methylphenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | Cc1c(COC(=O)N=C(N)N)cccc1-c1cnc(N2CC(=NOCC3COC(C)(C)OC3)C2)c(F)c1 |
| InChI | InChI=1S/C25H31FN6O5/c1-15-17(14-34-24(33)30-23(27)28)5-4-6-20(15)18-7-21(26)22(29-8-18)32-9-19(10-32)31-37-13-16-11-35-25(2,3)36-12-16/h4-8,16H,9-14H2,1-3H3,(H4,27,28,30,33) |
| InChIKey | FAHLAECXMFQWDF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|