C39H52F5NO3 — CID 134591597
tert-butyl (2S)-2-[4-[3-[(1R,2R)-6-tert-butyl-2-(2,3,4-trifluorophenyl)cycloheptyl]-3-oxopropyl]piperidin-1-yl]-3-(2,3-difluoro-4-methylphenyl)propanoate (PubChem CID 134591597) has the molecular formula C39H52F5NO3 and a molecular weight of 677.84 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-[3-[(1R,2R)-6-tert-butyl-2-(2,3,4-trifluorophenyl)cycloheptyl]-3-oxopropyl]piperidin-1-yl]-3-(2,3-difluoro-4-methylphenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-[4-[3-[(1R,2R)-6-tert-butyl-2-(2,3,4-trifluorophenyl)cycloheptyl]-3-oxopropyl]piperidin-1-yl]-3-(2,3-difluoro-4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 134591597 |
| Molecular Formula | C39H52F5NO3 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.39 |
| IUPAC Name | tert-butyl (2S)-2-[4-[3-[(1R,2R)-6-tert-butyl-2-(2,3,4-trifluorophenyl)cycloheptyl]-3-oxopropyl]piperidin-1-yl]-3-(2,3-difluoro-4-methylphenyl)propanoate |
| SMILES | Cc1ccc(C[C@@H](C(=O)OC(C)(C)C)N2CCC(CCC(=O)[C@@H]3CC(C(C)(C)C)CCC[C@H]3c3ccc(F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C39H52F5NO3/c1-23-11-13-25(34(42)33(23)41)21-31(37(47)48-39(5,6)7)45-19-17-24(18-20-45)12-16-32(46)29-22-26(38(2,3)4)9-8-10-27(29)28-14-15-30(40)36(44)35(28)43/h11,13-15,24,26-27,29,31H,8-10,12,16-22H2,1-7H3/t26?,27-,29+,31-/m0/s1 |
| InChIKey | OXSLRAKTSOJEOW-KABBSOHSSA-N |
| XLogP | 9.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|