C52H33F2N3 — CID 134591838
7-(3,5-dipyridin-3-ylphenyl)-11,23-bis(4-fluorophenyl)-2,13-dimethyl-10-azapentacyclo[12.9.0.03,12.04,9.015,20]tricosa-1(14),2,4(9),5,7,10,12,15,17,19,21,22-dodecaene (PubChem CID 134591838) has the molecular formula C52H33F2N3 and a molecular weight of 737.85 g/mol. Its IUPAC name is 7-(3,5-dipyridin-3-ylphenyl)-11,23-bis(4-fluorophenyl)-2,13-dimethyl-10-azapentacyclo[12.9.0.03,12.04,9.015,20]tricosa-1(14),2,4(9),5,7,10,12,15,17,19,21,22-dodecaene.
| Compound Name | 7-(3,5-dipyridin-3-ylphenyl)-11,23-bis(4-fluorophenyl)-2,13-dimethyl-10-azapentacyclo[12.9.0.03,12.04,9.015,20]tricosa-1(14),2,4(9),5,7,10,12,15,17,19,21,22-dodecaene |
|---|---|
| PubChem CID | 134591838 |
| Molecular Formula | C52H33F2N3 |
| Molecular Weight | 737.85 g/mol |
| Exact Mass | 737.26 |
| IUPAC Name | 7-(3,5-dipyridin-3-ylphenyl)-11,23-bis(4-fluorophenyl)-2,13-dimethyl-10-azapentacyclo[12.9.0.03,12.04,9.015,20]tricosa-1(14),2,4(9),5,7,10,12,15,17,19,21,22-dodecaene |
| SMILES | Cc1c2c(c(C)c3c1c(-c1ccc(F)cc1)nc1cc(-c4cc(-c5cccnc5)cc(-c5cccnc5)c4)ccc13)C(c1ccc(F)cc1)=C=Cc1ccccc1-2 |
| InChI | InChI=1S/C52H33F2N3/c1-31-48-45(34-11-17-42(53)18-12-34)21-15-33-7-3-4-10-44(33)49(48)32(2)51-50(31)46-22-16-36(28-47(46)57-52(51)35-13-19-43(54)20-14-35)39-25-40(37-8-5-23-55-29-37)27-41(26-39)38-9-6-24-56-30-38/h3-20,22-30H,1-2H3 |
| InChIKey | OUJZTXUAGNFAQE-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.85 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|