C52H48N2 — CID 134591959
N-cyclohexa-1,3-dien-1-yl-7,9,9-trimethyl-N-[4-[9-(4-phenylphenyl)carbazol-3-yl]cyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrofluoren-2-amine (PubChem CID 134591959) has the molecular formula C52H48N2 and a molecular weight of 700.97 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-7,9,9-trimethyl-N-[4-[9-(4-phenylphenyl)carbazol-3-yl]cyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrofluoren-2-amine.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-7,9,9-trimethyl-N-[4-[9-(4-phenylphenyl)carbazol-3-yl]cyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrofluoren-2-amine |
|---|---|
| PubChem CID | 134591959 |
| Molecular Formula | C52H48N2 |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-7,9,9-trimethyl-N-[4-[9-(4-phenylphenyl)carbazol-3-yl]cyclohexa-2,4-dien-1-yl]-1,7,8,9a-tetrahydrofluoren-2-amine |
| SMILES | CC1C=CC2=C(C1)C(C)(C)C1CC(N(C3=CC=CCC3)C3C=CC(c4ccc5c(c4)c4ccccc4n5-c4ccc(-c5ccccc5)cc4)=CC3)=CC=C21 |
| InChI | InChI=1S/C52H48N2/c1-35-18-29-44-45-30-28-43(34-49(45)52(2,3)48(44)32-35)53(40-14-8-5-9-15-40)41-24-21-38(22-25-41)39-23-31-51-47(33-39)46-16-10-11-17-50(46)54(51)42-26-19-37(20-27-42)36-12-6-4-7-13-36/h4-8,10-14,16-24,26-31,33,35,41,49H,9,15,25,32,34H2,1-3H3 |
| InChIKey | DYEBTDUUFNOXBF-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |