C11H11F5N2O2 — CID 134592054
1-(2,2,3,3,3-pentafluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione (PubChem CID 134592054) has the molecular formula C11H11F5N2O2 and a molecular weight of 298.21 g/mol. Its IUPAC name is 1-(2,2,3,3,3-pentafluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione.
| Compound Name | 1-(2,2,3,3,3-pentafluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 134592054 |
| Molecular Formula | C11H11F5N2O2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(2,2,3,3,3-pentafluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CC(F)(F)C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C11H11F5N2O2/c12-10(13,11(14,15)16)5-18-7-4-2-1-3-6(7)8(19)17-9(18)20/h1-5H2,(H,17,19,20) |
| InChIKey | DWYUHIYMZWFBIA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|