C20H18N4OS — CID 134592107
6-[5-(3-sulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 134592107) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 6-[5-(3-sulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 6-[5-(3-sulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 134592107 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 6-[5-(3-sulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | NC(=O)N1CCCc2cc(-c3cncc(-c4cccc(S)c4)c3)cnc21 |
| InChI | InChI=1S/C20H18N4OS/c21-20(25)24-6-2-4-14-7-17(12-23-19(14)24)16-8-15(10-22-11-16)13-3-1-5-18(26)9-13/h1,3,5,7-12,26H,2,4,6H2,(H2,21,25) |
| InChIKey | QVBUPFHBWPYRRR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|