About 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one
3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one (PubChem CID 134592736) has the molecular formula C17H17N3O3
and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one |
| PubChem CID | 134592736 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one |
| SMILES | CC1(CN=O)Cc2ncn(-c3ccc4c(c3)CCC4)c2C(=O)O1 |
| InChI | InChI=1S/C17H17N3O3/c1-17(9-19-22)8-14-15(16(21)23-17)20(10-18-14)13-6-5-11-3-2-4-12(11)7-13/h5-7,10H,2-4,8-9H2,1H3 |
| InChIKey | HTIDDDOBBCVQFO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one?
The IUPAC name of 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one (CID 134592736) is 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one.
What is the SMILES notation for 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one?
The canonical SMILES for 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one is CC1(CN=O)Cc2ncn(-c3ccc4c(c3)CCC4)c2C(=O)O1.
What is the InChIKey of 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one?
The InChIKey is HTIDDDOBBCVQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3/c1-17(9-19-22)8-14-15(16(21)23-17)20(10-18-14)13-6-5-11-3-2-4-12(11)7-13/h5-7,10H,2-4,8-9H2,1H3.
What are the key properties of 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one?
3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one has a molecular weight of 311.34 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-inden-5-yl)-6-methyl-6-(nitrosomethyl)-7H-pyrano[3,4-d]imidazol-4-one is sourced from PubChem (CID 134592736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).