C13H19Cl2N3 — CID 134593186
N-(2-aminoethyl)-N'-[(6,7-dichloro-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]ethanimidamide (PubChem CID 134593186) has the molecular formula C13H19Cl2N3 and a molecular weight of 288.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[(6,7-dichloro-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]ethanimidamide.
| Compound Name | N-(2-aminoethyl)-N'-[(6,7-dichloro-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 134593186 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-(2-aminoethyl)-N'-[(6,7-dichloro-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]ethanimidamide |
| SMILES | C/C(=N\CC1=CC=CC(C)C(Cl)=C1Cl)NCCN |
| InChI | InChI=1S/C13H19Cl2N3/c1-9-4-3-5-11(13(15)12(9)14)8-18-10(2)17-7-6-16/h3-5,9H,6-8,16H2,1-2H3,(H,17,18) |
| InChIKey | VAYFZSRZCLYMRW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|