C20H25NO2 — CID 134593491
10,10-dimethyl-5-[(E)-prop-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ol (PubChem CID 134593491) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 10,10-dimethyl-5-[(E)-prop-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ol.
| Compound Name | 10,10-dimethyl-5-[(E)-prop-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ol |
|---|---|
| PubChem CID | 134593491 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 10,10-dimethyl-5-[(E)-prop-1-enyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ol |
| SMILES | C/C=C/C1=Cc2cc3c4c(c2OC1O)CCCN4CCC3(C)C |
| InChI | InChI=1S/C20H25NO2/c1-4-6-13-11-14-12-16-17-15(18(14)23-19(13)22)7-5-9-21(17)10-8-20(16,2)3/h4,6,11-12,19,22H,5,7-10H2,1-3H3/b6-4+ |
| InChIKey | FVFUHFVUXCPWKR-GQCTYLIASA-N |
| XLogP | 3.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|