C30H19BrO5 — CID 134593681
6-[10-(4-bromonaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 134593681) has the molecular formula C30H19BrO5 and a molecular weight of 539.38 g/mol. Its IUPAC name is 6-[10-(4-bromonaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-(4-bromonaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 134593681 |
| Molecular Formula | C30H19BrO5 |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | 6-[10-(4-bromonaphthalen-1-yl)anthracen-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2c3ccccc3c(-c3ccc(Br)c4ccccc34)c3ccccc23)c(O)c1O |
| InChI | InChI=1S/C30H19BrO5/c31-22-14-13-21(15-7-1-2-8-16(15)22)23-17-9-3-5-11-19(17)24(20-12-6-4-10-18(20)23)25-26(32)28(34)30(36)29(35)27(25)33/h1-14,32-36H |
| InChIKey | GRRQJRDKVIPDOT-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|