C21H30FN — CID 134594022
(2E,4E,6E,8E)-5-(cyclopropylmethyl)-2-ethenyl-N-ethyl-9-fluoro-3-methyl-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-1-amine (PubChem CID 134594022) has the molecular formula C21H30FN and a molecular weight of 315.48 g/mol. Its IUPAC name is (2E,4E,6E,8E)-5-(cyclopropylmethyl)-2-ethenyl-N-ethyl-9-fluoro-3-methyl-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6E,8E)-5-(cyclopropylmethyl)-2-ethenyl-N-ethyl-9-fluoro-3-methyl-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 134594022 |
| Molecular Formula | C21H30FN |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | (2E,4E,6E,8E)-5-(cyclopropylmethyl)-2-ethenyl-N-ethyl-9-fluoro-3-methyl-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-1-amine |
| SMILES | C=C/C(CNCC)=C(C)\C=C(CC1CC1)\C(/C=C\C)=C\C=C\F |
| InChI | InChI=1S/C21H30FN/c1-5-9-20(10-8-13-22)21(15-18-11-12-18)14-17(4)19(6-2)16-23-7-3/h5-6,8-10,13-14,18,23H,2,7,11-12,15-16H2,1,3-4H3/b9-5-,13-8+,19-17+,20-10+,21-14+ |
| InChIKey | HNHZPEGEJZHWEX-WISWUDSJSA-N |
| XLogP | 5.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|