C14H22N2 — CID 134594116
(E)-3-N-[(Z)-but-2-enylidene]-2-ethenyl-1-N,4-dimethylhex-2-ene-1,3-diimine (PubChem CID 134594116) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (E)-3-N-[(Z)-but-2-enylidene]-2-ethenyl-1-N,4-dimethylhex-2-ene-1,3-diimine.
| Compound Name | (E)-3-N-[(Z)-but-2-enylidene]-2-ethenyl-1-N,4-dimethylhex-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 134594116 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (E)-3-N-[(Z)-but-2-enylidene]-2-ethenyl-1-N,4-dimethylhex-2-ene-1,3-diimine |
| SMILES | C=CC(/C=N/C)=C(\N=C\C=C/C)C(C)CC |
| InChI | InChI=1S/C14H22N2/c1-6-9-10-16-14(12(4)7-2)13(8-3)11-15-5/h6,8-12H,3,7H2,1-2,4-5H3/b9-6-,14-13+,15-11+,16-10+ |
| InChIKey | MKVGLAUBFNQTJL-XOZSZFJZSA-N |
| XLogP | 3.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|