About 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole
5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole (PubChem CID 134594340) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole.
Molecular Properties
| Compound Name | 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole |
| PubChem CID | 134594340 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole |
| SMILES | C=CC1=CC(C2=C(C)CC(C)=N2)=C(CC)CC1 |
| InChI | InChI=1S/C16H21N/c1-5-13-7-8-14(6-2)15(10-13)16-11(3)9-12(4)17-16/h5,10H,1,6-9H2,2-4H3 |
| InChIKey | UCKLHRCJHQPLNV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole?
The IUPAC name of 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole (CID 134594340) is 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole.
What is the SMILES notation for 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole?
The canonical SMILES for 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole is C=CC1=CC(C2=C(C)CC(C)=N2)=C(CC)CC1.
What is the InChIKey of 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole?
The InChIKey is UCKLHRCJHQPLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N/c1-5-13-7-8-14(6-2)15(10-13)16-11(3)9-12(4)17-16/h5,10H,1,6-9H2,2-4H3.
What are the key properties of 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole?
5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole has a molecular weight of 227.35 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-ethenyl-2-ethylcyclohexa-1,5-dien-1-yl)-2,4-dimethyl-3H-pyrrole is sourced from PubChem (CID 134594340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).