C15H27F3N2 — CID 134594767
1-(2,3-dimethylpent-1-en-3-yl)-N-(1,1,1-trifluoropropan-2-yl)piperidin-4-amine (PubChem CID 134594767) has the molecular formula C15H27F3N2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 1-(2,3-dimethylpent-1-en-3-yl)-N-(1,1,1-trifluoropropan-2-yl)piperidin-4-amine.
| Compound Name | 1-(2,3-dimethylpent-1-en-3-yl)-N-(1,1,1-trifluoropropan-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 134594767 |
| Molecular Formula | C15H27F3N2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 1-(2,3-dimethylpent-1-en-3-yl)-N-(1,1,1-trifluoropropan-2-yl)piperidin-4-amine |
| SMILES | C=C(C)C(C)(CC)N1CCC(NC(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H27F3N2/c1-6-14(5,11(2)3)20-9-7-13(8-10-20)19-12(4)15(16,17)18/h12-13,19H,2,6-10H2,1,3-5H3 |
| InChIKey | TTYYEINVFBQXNW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|