About N-tert-butyl-1,1-diphenylmethanimine oxide
N-tert-butyl-1,1-diphenylmethanimine oxide (PubChem CID 13459480) has the molecular formula C17H19NO
and a molecular weight of 253.35 g/mol. Its IUPAC name is N-tert-butyl-1,1-diphenylmethanimine oxide.
Molecular Properties
| Compound Name | N-tert-butyl-1,1-diphenylmethanimine oxide |
| PubChem CID | 13459480 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-tert-butyl-1,1-diphenylmethanimine oxide |
| SMILES | CC(C)(C)[N+]([O-])=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-17(2,3)18(19)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | KWYJIKSZVDOWQP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1,1-diphenylmethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1,1-diphenylmethanimine oxide?
The IUPAC name of N-tert-butyl-1,1-diphenylmethanimine oxide (CID 13459480) is N-tert-butyl-1,1-diphenylmethanimine oxide.
What is the SMILES notation for N-tert-butyl-1,1-diphenylmethanimine oxide?
The canonical SMILES for N-tert-butyl-1,1-diphenylmethanimine oxide is CC(C)(C)[N+]([O-])=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-tert-butyl-1,1-diphenylmethanimine oxide?
The InChIKey is KWYJIKSZVDOWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c1-17(2,3)18(19)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3.
What are the key properties of N-tert-butyl-1,1-diphenylmethanimine oxide?
N-tert-butyl-1,1-diphenylmethanimine oxide has a molecular weight of 253.35 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1,1-diphenylmethanimine oxide is sourced from PubChem (CID 13459480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).